FL3FCCNS0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=2-(3,4-Dihydroxyphenyl)-5-hydroxy-7-methoxy-4H-1-benzopyran-4-one | + | |SysName=2- (3,4-Dihydroxyphenyl) -5-hydroxy-7-methoxy-4H-1-benzopyran-4-one |
− | |Common Name=&&5,3',4'-Trihydroxy-7-methoxyflavone&&7-O-Methylluteolin&&Luteolin 7-methyl ether&&2-(3,4-Dihydroxyphenyl)-5-hydroxy-7-methoxy-4H-1-benzopyran-4-one&& | + | |Common Name=&&5,3',4'-Trihydroxy-7-methoxyflavone&&7-O-Methylluteolin&&Luteolin 7-methyl ether&&2- (3,4-Dihydroxyphenyl) -5-hydroxy-7-methoxy-4H-1-benzopyran-4-one&& |
|CAS=20243-59-8 | |CAS=20243-59-8 | ||
|KNApSAcK=C00003865 | |KNApSAcK=C00003865 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 20243-59-8 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3FCCNS0001.mol |
5,3',4'-Trihydroxy-7-methoxyflavone | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 2- (3,4-Dihydroxyphenyl) -5-hydroxy-7-methoxy-4H-1-benzopyran-4-one |
Common Name |
|
Symbol | |
Formula | C16H12O6 |
Exact Mass | 300.063388116 |
Average Mass | 300.26288 |
SMILES | COc(c3)cc(O1)c(c(O)3)C(=O)C=C1c(c2)cc(O)c(O)c2 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |