FL3FALNP0015
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=2H,(-)-8-(2,4-Dihydroxyphenyl)-5-hydroxy-2-methyl-2-(4-methyl-3-pentenyl)-6H-benzo[1,2-b:5,4-b']dipyran-6-one |
|Common Name=&&Australone A&&2H,(-)-8-(2,4-Dihydroxyphenyl)-5-hydroxy-2-methyl-2-(4-methyl-3-pentenyl)-6H-benzo[1,2-b:5,4-b']dipyran-6-one&& | |Common Name=&&Australone A&&2H,(-)-8-(2,4-Dihydroxyphenyl)-5-hydroxy-2-methyl-2-(4-methyl-3-pentenyl)-6H-benzo[1,2-b:5,4-b']dipyran-6-one&& | ||
|CAS=196705-71-2 | |CAS=196705-71-2 | ||
|KNApSAcK=C00013442 | |KNApSAcK=C00013442 | ||
}} | }} | ||
Revision as of 09:00, 13 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 196705-71-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FALNP0015.mol |
| Australone A | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2H,(-)-8-(2,4-Dihydroxyphenyl)-5-hydroxy-2-methyl-2-(4-methyl-3-pentenyl)-6H-benzo[1,2-b:5,4-b']dipyran-6-one |
| Common Name |
|
| Symbol | |
| Formula | C25H24O6 |
| Exact Mass | 420.1572885 |
| Average Mass | 420.45446 |
| SMILES | C(c13)(=O)C=C(c(c4)c(O)cc(O)c4)Oc1cc(O2)c(c(O)3)C= |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
