FL3FAJNS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=2-(3,5-Dihydroxy-4-methoxyphenyl)-5,7-dihydroxy-4H-1-benzopyran-4-one | + | |SysName=2- (3,5-Dihydroxy-4-methoxyphenyl) -5,7-dihydroxy-4H-1-benzopyran-4-one |
| − | |Common Name=&&Tricetin 4'-methyl ether&&2-(3,5-Dihydroxy-4-methoxyphenyl)-5,7-dihydroxy-4H-1-benzopyran-4-one&& | + | |Common Name=&&Tricetin 4'-methyl ether&&2- (3,5-Dihydroxy-4-methoxyphenyl) -5,7-dihydroxy-4H-1-benzopyran-4-one&& |
|CAS=90745-22-5 | |CAS=90745-22-5 | ||
|KNApSAcK=C00003914 | |KNApSAcK=C00003914 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 90745-22-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FAJNS0001.mol |
| Tricetin 4'-methyl ether | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- (3,5-Dihydroxy-4-methoxyphenyl) -5,7-dihydroxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C16H12O7 |
| Exact Mass | 316.058302738 |
| Average Mass | 316.26228000000003 |
| SMILES | COc(c(O)3)c(O)cc(c3)C(=C1)Oc(c2)c(c(O)cc(O)2)C(=O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
