FL3FADCS0023
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5,7,4'-Trihydroxy-3'-methoxyflavone 8-C-[glucosyl-(1->6)-glucoside] | + | |SysName=5,7,4'-Trihydroxy-3'-methoxyflavone 8-C- [ glucosyl- (1->6) -glucoside ] |
| − | |Common Name=&&Scoparin 6"-O-glucoside&&5,7,4'-Trihydroxy-3'-methoxyflavone 8-C-[glucosyl-(1->6)-glucoside]&& | + | |Common Name=&&Scoparin 6"-O-glucoside&&5,7,4'-Trihydroxy-3'-methoxyflavone 8-C- [ glucosyl- (1->6) -glucoside ] && |
|CAS=605652-87-7 | |CAS=605652-87-7 | ||
|KNApSAcK=C00014068 | |KNApSAcK=C00014068 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 605652-87-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FADCS0023.mol |
| Scoparin 6"-O-glucoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,4'-Trihydroxy-3'-methoxyflavone 8-C- [ glucosyl- (1->6) -glucoside ] |
| Common Name |
|
| Symbol | |
| Formula | C28H32O16 |
| Exact Mass | 624.1690349759999 |
| Average Mass | 624.54408 |
| SMILES | OC(C1c(c34)c(cc(c3C(=O)C=C(c(c5)ccc(c5OC)O)O4)O)O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
