FL3FACDS0011
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5,7,3',4'-Tetrahydroxyflavone 6-C-[glucosyl-(1->2)-glucoside]-4'-O-glucoside | + | |SysName=5,7,3',4'-Tetrahydroxyflavone 6-C- [ glucosyl- (1->2) -glucoside ] -4'-O-glucoside |
| − | |Common Name=&&Isoorientin 4',2"-di-O-glucoside&&5,7,3',4'-Tetrahydroxyflavone 6-C-[glucosyl-(1->2)-glucoside]-4'-O-glucoside&& | + | |Common Name=&&Isoorientin 4',2"-di-O-glucoside&&5,7,3',4'-Tetrahydroxyflavone 6-C- [ glucosyl- (1->2) -glucoside ] -4'-O-glucoside&& |
|CAS=63316-26-7 | |CAS=63316-26-7 | ||
|KNApSAcK=C00006313 | |KNApSAcK=C00006313 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 63316-26-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FACDS0011.mol |
| Isoorientin 4',2"-di-O-glucoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,3',4'-Tetrahydroxyflavone 6-C- [ glucosyl- (1->2) -glucoside ] -4'-O-glucoside |
| Common Name |
|
| Symbol | |
| Formula | C33H40O21 |
| Exact Mass | 772.206208342 |
| Average Mass | 772.6581 |
| SMILES | OC(C1OC(C(O)6)OC(CO)C(C(O)6)O)C(O)C(CO)OC1c(c(O)2) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
