FL3FABGS0013
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=5,7-Dihydroxy-4'-methoxyflavone 7-(6"-acetylglucoside) | + | |SysName=5,7-Dihydroxy-4'-methoxyflavone 7- (6"-acetylglucoside) |
− | |Common Name=&&Acacetin 7-(6"-acetylglucoside)&&5,7-Dihydroxy-4'-methoxyflavone 7-(6"-acetylglucoside)&& | + | |Common Name=&&Acacetin 7- (6"-acetylglucoside) &&5,7-Dihydroxy-4'-methoxyflavone 7- (6"-acetylglucoside) && |
|CAS=76410-61-2 | |CAS=76410-61-2 | ||
|KNApSAcK=C00004245 | |KNApSAcK=C00004245 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 76410-61-2 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3FABGS0013.mol |
Acacetin 7- (6"-acetylglucoside) | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 5,7-Dihydroxy-4'-methoxyflavone 7- (6"-acetylglucoside) |
Common Name |
|
Symbol | |
Formula | C24H24O11 |
Exact Mass | 488.13186161 |
Average Mass | 488.44076 |
SMILES | Oc(c1)c(C(=O)4)c(OC(=C4)c(c3)ccc(c3)OC)cc1OC(C2O)O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|