FL3FABGS0012
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=5,7-Dihydroxy-4'-methoxyflavone 7-rhamnosyl-(1->4")[glucosyl-(1->6")(6"'-acetylsophoroside)] |
|Common Name=&&Acacetin 7-rhamnosyl-(1->4")[glucosyl-(1->6")(6"'-acetylsophoroside)]&& | |Common Name=&&Acacetin 7-rhamnosyl-(1->4")[glucosyl-(1->6")(6"'-acetylsophoroside)]&& | ||
|CAS=109517-74-0 | |CAS=109517-74-0 | ||
|KNApSAcK=C00004213 | |KNApSAcK=C00004213 | ||
}} | }} | ||
Revision as of 09:00, 13 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 109517-74-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FABGS0012.mol |
| Acacetin 7-rhamnosyl-(1->4")[glucosyl-(1->6")(6"'-acetylsophoroside)] | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7-Dihydroxy-4'-methoxyflavone 7-rhamnosyl-(1->4")[glucosyl-(1->6")(6"'-acetylsophoroside)] |
| Common Name |
|
| Symbol | |
| Formula | C42H54O25 |
| Exact Mass | 958.2954172780001 |
| Average Mass | 958.86316 |
| SMILES | c(O6)(c(C(C=C6c(c7)ccc(c7)OC)=O)5)cc(cc(O)5)OC(O1) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
