FL3FAAGS0016
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=5,7,4'-Trihydroxyflavone 7-alpha-L-arabinofuranosyl-(1->6)-glucoside | + | |SysName=5,7,4'-Trihydroxyflavone 7-alpha-L-arabinofuranosyl- (1->6) -glucoside |
− | |Common Name=&&Apigenin 7-alpha-L-arabinofuranosyl-(1->6)-glucoside&&5,7,4'-Trihydroxyflavone 7-alpha-L-arabinofuranosyl-(1->6)-glucoside&& | + | |Common Name=&&Apigenin 7-alpha-L-arabinofuranosyl- (1->6) -glucoside&&5,7,4'-Trihydroxyflavone 7-alpha-L-arabinofuranosyl- (1->6) -glucoside&& |
|CAS=111537-39-4 | |CAS=111537-39-4 | ||
|KNApSAcK=C00004151 | |KNApSAcK=C00004151 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 111537-39-4 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3FAAGS0016.mol |
Apigenin 7-alpha-L-arabinofuranosyl- (1->6) -glucoside | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 5,7,4'-Trihydroxyflavone 7-alpha-L-arabinofuranosyl- (1->6) -glucoside |
Common Name |
|
Symbol | |
Formula | C26H28O14 |
Exact Mass | 564.147905604 |
Average Mass | 564.49212 |
SMILES | C(C=4)(=O)c(c3OC4c(c5)ccc(c5)O)c(O)cc(c3)OC(C(O)1) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|