FL3FA9NP0004
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 15 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 64125-33-3 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3FA9NP0004.mol |
Candidin (Tephrosia) | |
---|---|
Structural Information | |
Systematic Name | 5-Methoxy-8,8-dimethyl-2-phenyl-4H,8H-benzo[1,2-b:3,4-b']dipyran-4-one |
Common Name |
|
Symbol | |
Formula | C21H18O4 |
Exact Mass | 334.120509064 |
Average Mass | 334.36521999999997 |
SMILES | COc(c42)cc(O1)c(c2OC(=CC4=O)c(c3)cccc3)C=CC(C)(C)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|