FL3FA8NS0010
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 15 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 82475-00-1 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3FA8NS0010.mol |
5,7,2',6'-Tetrahydroxyflavone | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 2-(2,6-Dihydroxyphenyl)-5,7-dihydroxy-4H-1-benzopyran-4-one |
Common Name |
|
Symbol | |
Formula | C15H10O6 |
Exact Mass | 286.047738052 |
Average Mass | 286.2363 |
SMILES | Oc(c3)cc(O1)c(c(O)3)C(=O)C=C1c(c(O)2)c(O)ccc2 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|