FL2FHYNM0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=2,5-Dihydroxy-7-methoxy-6-methylflavanone |
|Common Name=&&2,5-Dihydroxy-7-methoxy-6-methylflavanone&& | |Common Name=&&2,5-Dihydroxy-7-methoxy-6-methylflavanone&& | ||
|CAS=186906-54-7 | |CAS=186906-54-7 | ||
|KNApSAcK=C00014144 | |KNApSAcK=C00014144 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 186906-54-7 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL2FHYNM0001.mol |
2,5-Dihydroxy-7-methoxy-6-methylflavanone | |
---|---|
![]() | |
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C17H16O5 |
Exact Mass | 300.099773622 |
Average Mass | 300.30593999999996 |
SMILES | COc(c1)c(C)c(O)c(C(=O)3)c1OC(O)(C3)c(c2)cccc2 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|