FL2FGANS0003
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| Line 1: | Line 1: | ||
| {{Metabolite | {{Metabolite | ||
| − | | | + | |Sysname=5-Hydroxy-6,7,8,4'-tetramethoxyflavanone | 
| |Common Name=&&5-Hydroxy-6,7,8,4'-tetramethoxyflavanone&& | |Common Name=&&5-Hydroxy-6,7,8,4'-tetramethoxyflavanone&& | ||
| |CAS=75917-10-1 | |CAS=75917-10-1 | ||
| |KNApSAcK=C00008276 | |KNApSAcK=C00008276 | ||
| }} | }} | ||
Revision as of 09:00, 12 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 75917-10-1 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FGANS0003.mol | 
| 5-Hydroxy-6,7,8,4'-tetramethoxyflavanone | |
|---|---|
|   | |
| Structural Information | |
| Systematic Name | |
| Common Name | 
 | 
| Symbol | |
| Formula | C19H20O7 | 
| Exact Mass | 360.120902994 | 
| Average Mass | 360.3579 | 
| SMILES | c(C(O2)CC(c(c3O)c2c(c(c3OC)OC)OC)=O)(c1)ccc(OC)c1 | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
| 
 | 
