FL2FFANS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(S)-2,3-Dihydro-5,7,8-trihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | + | |SysName= (S) -2,3-Dihydro-5,7,8-trihydroxy-2- (4-hydroxyphenyl) -4H-1-benzopyran-4-one |
| − | |Common Name=&&Isocarthamidin&&(S)-2,3-Dihydro-5,7,8-trihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one&& | + | |Common Name=&&Isocarthamidin&& (S) -2,3-Dihydro-5,7,8-trihydroxy-2- (4-hydroxyphenyl) -4H-1-benzopyran-4-one&& |
|CAS=2569-76-8 | |CAS=2569-76-8 | ||
|KNApSAcK=C00008232 | |KNApSAcK=C00008232 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 2569-76-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FFANS0001.mol |
| Isocarthamidin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (S) -2,3-Dihydro-5,7,8-trihydroxy-2- (4-hydroxyphenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C15H12O6 |
| Exact Mass | 288.063388116 |
| Average Mass | 288.25218 |
| SMILES | Oc(c3)ccc(c3)C(C1)Oc(c(O)2)c(c(O)cc(O)2)C(=O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
