FL2FDCNS0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=(2S)-5,7-Dimethoxy-3',4'-methylenedioxyflavanone | + | |SysName= (2S) -5,7-Dimethoxy-3',4'-methylenedioxyflavanone |
− | |Common Name=&&(2S)-5,7-Dimethoxy-3',4'-methylenedioxyflavanone&& | + | |Common Name=&& (2S) -5,7-Dimethoxy-3',4'-methylenedioxyflavanone&& |
|CAS=610770-50-8 | |CAS=610770-50-8 | ||
|KNApSAcK=C00014128 | |KNApSAcK=C00014128 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 610770-50-8 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL2FDCNS0001.mol |
(2S) -5,7-Dimethoxy-3',4'-methylenedioxyflavanone | |
---|---|
![]() | |
Structural Information | |
Systematic Name | (2S) -5,7-Dimethoxy-3',4'-methylenedioxyflavanone |
Common Name |
|
Symbol | |
Formula | C18H16O6 |
Exact Mass | 328.094688244 |
Average Mass | 328.31604 |
SMILES | O(C(c(c4)cc(c3c4)OCO3)2)c(c(C(=O)C2)1)cc(OC)cc1OC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|
|