FL2FABNI0009
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|SysName=5,7-Dihydroxy-4'-methoxy-3'-prenyl-5'- [ (3-methyl-2-butenyl) phenyl ] flavanone | |SysName=5,7-Dihydroxy-4'-methoxy-3'-prenyl-5'- [ (3-methyl-2-butenyl) phenyl ] flavanone | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FAB Isosakuranetin (27 pages) : FL2FABNI Non-cyclic prenyl substituted (8 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 213819-43-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FABNI0009.mol |
| Burttinone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7-Dihydroxy-4'-methoxy-3'-prenyl-5'- [ (3-methyl-2-butenyl) phenyl ] flavanone |
| Common Name |
|
| Symbol | |
| Formula | C26H30O6 |
| Exact Mass | 438.204238692 |
| Average Mass | 438.51279999999997 |
| SMILES | c(c1)(C(C3)Oc(c(C3=O)2)cc(O)cc2O)cc(CC=C(C)C)c(OC) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
