FL2FAANI0022
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=(2S)-5,7,4'-Trihydroxy-6-(1,1-dimethylallyl)flavanone | + | |SysName= (2S) -5,7,4'-Trihydroxy-6- (1,1-dimethylallyl) flavanone |
− | |Common Name=&&(2S)-5,7,4'-Trihydroxy-6-(1,1-dimethylallyl)flavanone&& | + | |Common Name=&& (2S) -5,7,4'-Trihydroxy-6- (1,1-dimethylallyl) flavanone&& |
|CAS=192572-93-3 | |CAS=192572-93-3 | ||
|KNApSAcK=C00014179 | |KNApSAcK=C00014179 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 192572-93-3 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL2FAANI0022.mol |
(2S) -5,7,4'-Trihydroxy-6- (1,1-dimethylallyl) flavanone | |
---|---|
![]() | |
Structural Information | |
Systematic Name | (2S) -5,7,4'-Trihydroxy-6- (1,1-dimethylallyl) flavanone |
Common Name |
|
Symbol | |
Formula | C20H20O5 |
Exact Mass | 340.13107375 |
Average Mass | 340.3698 |
SMILES | C=CC(C)(C)c(c(O)3)c(O)c(C(=O)2)c(c3)OC(C2)c(c1)ccc |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|