FL2FA8NP0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=3,4-Dihydro-2alpha-(2-hydroxyphenyl)-5-hydroxy-8,8-dimethyl-10-(3-methyl-2-butenyl)-2H,8H-benzo[1,2-b:5,4-b']dipyran-4-one | + | |SysName=3,4-Dihydro-2alpha- (2-hydroxyphenyl) -5-hydroxy-8,8-dimethyl-10- (3-methyl-2-butenyl) -2H,8H-benzo [ 1,2-b:5,4-b' ] dipyran-4-one |
| − | |Common Name=&&Minimiflorin&&3,4-Dihydro-2alpha-(2-hydroxyphenyl)-5-hydroxy-8,8-dimethyl-10-(3-methyl-2-butenyl)-2H,8H-benzo[1,2-b:5,4-b']dipyran-4-one&& | + | |Common Name=&&Minimiflorin&&3,4-Dihydro-2alpha- (2-hydroxyphenyl) -5-hydroxy-8,8-dimethyl-10- (3-methyl-2-butenyl) -2H,8H-benzo [ 1,2-b:5,4-b' ] dipyran-4-one&& |
|CAS=98621-33-1 | |CAS=98621-33-1 | ||
|KNApSAcK=C00008261 | |KNApSAcK=C00008261 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 98621-33-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FA8NP0001.mol |
| Minimiflorin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,4-Dihydro-2alpha- (2-hydroxyphenyl) -5-hydroxy-8,8-dimethyl-10- (3-methyl-2-butenyl) -2H,8H-benzo [ 1,2-b:5,4-b' ] dipyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C25H26O5 |
| Exact Mass | 406.178023942 |
| Average Mass | 406.47094 |
| SMILES | C(=O)(c31)CC(c(c4O)cccc4)Oc1c(CC=C(C)C)c(O2)c(c3O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
