FL2F2CNP0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=Ponganone IV | + | |SysName=Ponganone IV |
|Common Name=&&Ponganone IV&&(2S)-6,3',4'-Trimethoxy-6",6"-dimethylpyrano[2",3":7,8]flavanone&& | |Common Name=&&Ponganone IV&&(2S)-6,3',4'-Trimethoxy-6",6"-dimethylpyrano[2",3":7,8]flavanone&& | ||
|CAS=142608-90-0 | |CAS=142608-90-0 | ||
|KNApSAcK=C00014244 | |KNApSAcK=C00014244 | ||
}} | }} | ||
Revision as of 09:00, 10 March 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 142608-90-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2F2CNP0002.mol |
| Ponganone IV | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Ponganone IV |
| Common Name |
|
| Symbol | |
| Formula | C23H24O6 |
| Exact Mass | 396.1572885 |
| Average Mass | 396.43306 |
| SMILES | c(C(O2)CC(c(c4)c(c(c(c4OC)3)C=CC(O3)(C)C)2)=O)(c1) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
