FL1DHXNS0002
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=2-Hydroxy-1-(2-hydroxy-4-methoxyphenyl)-3-(4-methoxyphenyl)-1-propanone | + | |SysName=2-Hydroxy-1- (2-hydroxy-4-methoxyphenyl) -3- (4-methoxyphenyl) -1-propanone |
− | |Common Name=&&Odoratol&&2-Hydroxy-1-(2-hydroxy-4-methoxyphenyl)-3-(4-methoxyphenyl)-1-propanone&& | + | |Common Name=&&Odoratol&&2-Hydroxy-1- (2-hydroxy-4-methoxyphenyl) -3- (4-methoxyphenyl) -1-propanone&& |
|CAS=94943-12-1 | |CAS=94943-12-1 | ||
|KNApSAcK=C00000988 | |KNApSAcK=C00000988 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 94943-12-1 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL1DHXNS0002.mol |
Odoratol | |
---|---|
Structural Information | |
Systematic Name | 2-Hydroxy-1- (2-hydroxy-4-methoxyphenyl) -3- (4-methoxyphenyl) -1-propanone |
Common Name |
|
Symbol | |
Formula | C17H18O5 |
Exact Mass | 302.115423686 |
Average Mass | 302.32182 |
SMILES | COc(c2)ccc(c2)C[C@@H](O)C(=O)c(c1)c(O)cc(OC)c1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|
|