FL1CQUNM0005
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=[(1R)-5-Oxo-6-(1-hydroxy-3-phenyl-2-propenylidene)-3-cyclohexenyl]acetic acid methyl ester | |SysName=[(1R)-5-Oxo-6-(1-hydroxy-3-phenyl-2-propenylidene)-3-cyclohexenyl]acetic acid methyl ester | ||
− | |Common Name=&&Infectocaryone&& | + | |Common Name=&&Infectocaryone&&[(1R)-5-Oxo-6-(1-hydroxy-3-phenyl-2-propenylidene)-3-cyclohexenyl]acetic acid methyl ester&& |
|CAS=371194-02-4 | |CAS=371194-02-4 | ||
|KNApSAcK=C00014584 | |KNApSAcK=C00014584 | ||
}} | }} |
Revision as of 09:00, 15 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 371194-02-4 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL1CQUNM0005.mol |
Infectocaryone | |
---|---|
Structural Information | |
Systematic Name | [(1R)-5-Oxo-6-(1-hydroxy-3-phenyl-2-propenylidene)-3-cyclohexenyl]acetic acid methyl ester |
Common Name |
|
Symbol | |
Formula | C18H18O4 |
Exact Mass | 298.120509064 |
Average Mass | 298.33312 |
SMILES | C(C1=C(O)C=Cc(c2)cccc2)(CC=CC1=O)CC(=O)OC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|