FL1CHYNF0003
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=1-(4-Methoxybenzofuran-5-yl)-3-phenyl-1,3-propanedione | + | |SysName=1- (4-Methoxybenzofuran-5-yl) -3-phenyl-1,3-propanedione |
| − | |Common Name=&&Pongamol&&1-(4-Methoxybenzofuran-5-yl)-3-phenyl-1,3-propanedione&& | + | |Common Name=&&Pongamol&&1- (4-Methoxybenzofuran-5-yl) -3-phenyl-1,3-propanedione&& |
|CAS=484-33-3 | |CAS=484-33-3 | ||
|KNApSAcK=C00007018 | |KNApSAcK=C00007018 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 484-33-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CHYNF0003.mol |
| Pongamol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 1- (4-Methoxybenzofuran-5-yl) -3-phenyl-1,3-propanedione |
| Common Name |
|
| Symbol | |
| Formula | C18H14O4 |
| Exact Mass | 294.089208936 |
| Average Mass | 294.30136 |
| SMILES | c(c23)(occ3)ccc(c2OC)C(=O)CC(=O)c(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
