FL1CG9NI0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=6-[(E)-3-Phenylacryloyl]-4-(2-methylbutyryloxy)-2,5-dimethoxybenzene-1,3-diol | |SysName=6-[(E)-3-Phenylacryloyl]-4-(2-methylbutyryloxy)-2,5-dimethoxybenzene-1,3-diol | ||
| − | |Common Name=&&Melafolone&& | + | |Common Name=&&Melafolone&&6-[(E)-3-Phenylacryloyl]-4-(2-methylbutyryloxy)-2,5-dimethoxybenzene-1,3-diol&& |
|CAS=129724-42-1 | |CAS=129724-42-1 | ||
|KNApSAcK=C00007118 | |KNApSAcK=C00007118 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 129724-42-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CG9NI0002.mol |
| Melafolone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 6-[(E)-3-Phenylacryloyl]-4-(2-methylbutyryloxy)-2,5-dimethoxybenzene-1,3-diol |
| Common Name |
|
| Symbol | |
| Formula | C22H24O7 |
| Exact Mass | 400.152203122 |
| Average Mass | 400.42176000000006 |
| SMILES | C(C(=O)c(c2OC)c(c(c(c2OC(C(C)CC)=O)O)OC)O)=Cc(c1)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
