FL1CE9NI0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |Sysname=2',4'-Dihydroxy-6'-methoxy-3'-(2-methylbutyryloxy)chalcone |
|Common Name=&&2',4'-Dihydroxy-6'-methoxy-3'-(2-methylbutyryloxy)chalcone&& | |Common Name=&&2',4'-Dihydroxy-6'-methoxy-3'-(2-methylbutyryloxy)chalcone&& | ||
|CAS=116988-11-5 | |CAS=116988-11-5 | ||
|KNApSAcK=C00007106 | |KNApSAcK=C00007106 | ||
}} | }} | ||
Revision as of 09:00, 12 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 116988-11-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CE9NI0002.mol |
| 2',4'-Dihydroxy-6'-methoxy-3'-(2-methylbutyryloxy)chalcone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | |
| Common Name |
|
| Symbol | |
| Formula | C21H22O6 |
| Exact Mass | 370.141638436 |
| Average Mass | 370.39578 |
| SMILES | COc(c2)c(c(c(OC(=O)C(C)CC)c(O)2)O)C(=O)C=Cc(c1)ccc |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
