FL1C1ANF0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |Sysname=4",5"-Dihydro-4,2'-dihydroxy-5"-(2-hydroxy-isopropyl)furano[2",3":4',3']chalcone |
|Common Name=&&Bakuchalcone&& | |Common Name=&&Bakuchalcone&& | ||
|CAS=84575-13-3 | |CAS=84575-13-3 | ||
|KNApSAcK=C00007060 | |KNApSAcK=C00007060 | ||
}} | }} | ||
Revision as of 09:00, 12 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 84575-13-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C1ANF0002.mol |
| Bakuchalcone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | |
| Common Name |
|
| Symbol | |
| Formula | C20H20O5 |
| Exact Mass | 340.13107375 |
| Average Mass | 340.3698 |
| SMILES | Oc(c3)ccc(c3)C=CC(c(c(O)2)ccc(c21)OC(C(C)(C)O)C1)= |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
