FL1BAANS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=2,4,6-Trihydroxy-2-[(4-hydroxyphenyl)methyl]benzofuran-3(2H)-one | + | |SysName=2,4,6-Trihydroxy-2- [ (4-hydroxyphenyl) methyl ] benzofuran-3 (2H) -one |
| − | |Common Name=&&Maesopsin&&2,4,6-Trihydroxy-2-[(4-hydroxyphenyl)methyl]benzofuran-3(2H)-one&& | + | |Common Name=&&Maesopsin&&2,4,6-Trihydroxy-2- [ (4-hydroxyphenyl) methyl ] benzofuran-3 (2H) -one&& |
|CAS=5989-16-2 | |CAS=5989-16-2 | ||
|KNApSAcK=C00008066 | |KNApSAcK=C00008066 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 5989-16-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1BAANS0001.mol |
| Maesopsin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2,4,6-Trihydroxy-2- [ (4-hydroxyphenyl) methyl ] benzofuran-3 (2H) -one |
| Common Name |
|
| Symbol | |
| Formula | C15H12O6 |
| Exact Mass | 288.063388116 |
| Average Mass | 288.25218 |
| SMILES | Oc(c3)ccc(c3)CC(O)(O1)C(=O)c(c(O)2)c(cc(O)c2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
