BMMCQN--m007
From Metabolomics.JP
(Difference between revisions)
| Line 2: | Line 2: | ||
|SysName=Indole-5,6-quinone | |SysName=Indole-5,6-quinone | ||
|Common Name=&&Indole-5,6-quinone&& | |Common Name=&&Indole-5,6-quinone&& | ||
| − | |CAS= | + | |CAS=582-59-2 |
|KEGG=C05579 | |KEGG=C05579 | ||
}} | }} | ||
Revision as of 09:00, 14 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 582-59-2 |
| KEGG | C05579 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCQN--m007.mol |
| Indole-5,6-quinone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Indole-5,6-quinone |
| Common Name |
|
| Symbol | |
| Formula | C8H5NO2 |
| Exact Mass | 147.032 |
| Average Mass | 147.1308 |
| SMILES | O=c(c1)c(=O)cc(n2)c(cc2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
