BMMCHC--k014
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 72698-24-9 |
| KEGG | C03671 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCHC--k014.mol |
| 2-Pyrone-4,6-dicarboxylate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2-Pyrone-4,6-dicarboxylic acid |
| Common Name |
|
| Symbol | |
| Formula | C7H4O6 |
| Exact Mass | 184.0007 |
| Average Mass | 184.103 |
| SMILES | OC(=O)C(=C1)C=C(OC(=O)1)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
