BMMCBZ4Sk008
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 480-64-8 |
KEGG | C01839 |
KNApSAcK | |
CDX file | |
MOL file | BMMCBZ4Sk008.mol |
Orsellinate | |
---|---|
![]() | |
Structural Information | |
Systematic Name | o-Orsellinic acid |
Common Name |
|
Symbol | |
Formula | C8H8O4 |
Exact Mass | 168.0422 |
Average Mass | 168.1467 |
SMILES | Oc(c1)cc(O)c(C(O)=O)c(C)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |