BMMCBZ2Pf042
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 5363-54-2 |
| KEGG | C06679 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCBZ2Pf042.mol |
| |
| Structural Information | |
| Systematic Name | 4-Sulfo-benzaldehyde |
| Common Name | |
| Symbol | |
| Formula | C7H6O4S |
| Exact Mass | 185.9986 |
| Average Mass | 186.1861 |
| SMILES | O=Cc(c1)ccc(c1)S(O)(=O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
