BMMCBZ2Pd006
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=2-(4'-Chlorophenyl)-3,3-dichloro-propenoic acid | + | |SysName=2- (4'-Chlorophenyl) -3,3-dichloro-propenoic acid |
− | |Common Name=&&2-(4'-Chlorophenyl)-3,3-dichloropropenoate&& | + | |Common Name=&&2- (4'-Chlorophenyl) -3,3-dichloropropenoate&& |
|CAS=? | |CAS=? | ||
|KEGG=C06646 | |KEGG=C06646 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C06646 |
KNApSAcK | |
CDX file | |
MOL file | BMMCBZ2Pd006.mol |
2- (4'-Chlorophenyl) -3,3-dichloropropenoate | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 2- (4'-Chlorophenyl) -3,3-dichloro-propenoic acid |
Common Name |
|
Symbol | |
Formula | C9H7Cl3O2 |
Exact Mass | 251.9511 |
Average Mass | 253.5087 |
SMILES | OC(=O)C(c(c1)ccc(Cl)c1)C(Cl)Cl |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways