BMMCACDEk007
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=cis-3-(1-Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol | + | |SysName=cis-3- (1-Carboxy-ethyl) -3,5-cyclo-hexadiene-1,2-diol |
| − | |Common Name=&&cis-3-(1-Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol&& | + | |Common Name=&&cis-3- (1-Carboxy-ethyl) -3,5-cyclo-hexadiene-1,2-diol&& |
|CAS=? | |CAS=? | ||
|KEGG=C11456 | |KEGG=C11456 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | ? |
| KEGG | C11456 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCACDEk007.mol |
| cis-3- (1-Carboxy-ethyl) -3,5-cyclo-hexadiene-1,2-diol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | cis-3- (1-Carboxy-ethyl) -3,5-cyclo-hexadiene-1,2-diol |
| Common Name |
|
| Symbol | |
| Formula | C9H12O4 |
| Exact Mass | 184.0735 |
| Average Mass | 184.1891 |
| SMILES | OC(=O)C(C)C(=C1)C(O)C(O)C=C1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
