BMFYS3CAf003
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=(S)-3-Sulfo-lactic acid | + | |SysName= (S) -3-Sulfo-lactic acid |
− | |Common Name=&&(S)-3-Sulfolactate&& | + | |Common Name=&& (S) -3-Sulfolactate&& |
|CAS=? | |CAS=? | ||
|KEGG=C11499 | |KEGG=C11499 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C11499 |
KNApSAcK | |
CDX file | |
MOL file | BMFYS3CAf003.mol |
(S) -3-Sulfolactate | |
---|---|
![]() | |
Structural Information | |
Systematic Name | (S) -3-Sulfo-lactic acid |
Common Name |
|
Symbol | |
Formula | C3H6O6S |
Exact Mass | 169.9885 |
Average Mass | 170.1421 |
SMILES | O[C@H](C(O)=O)CS(O)(=O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways