BMFYB6DAk006
From Metabolomics.JP
(Difference between revisions)
Line 2: | Line 2: | ||
|SysName=cis-Homoaconitic acid | |SysName=cis-Homoaconitic acid | ||
|Common Name=&&But-1-ene-1,2,4-tricarboxylate&&Homo-cis-aconitate&&cis-Homoaconitate&&(Z)-1,2,4-But-1-enetricarboxylic acid&& | |Common Name=&&But-1-ene-1,2,4-tricarboxylate&&Homo-cis-aconitate&&cis-Homoaconitate&&(Z)-1,2,4-But-1-enetricarboxylic acid&& | ||
− | |CAS= | + | |CAS=7279-64-3 |
|KEGG=C04002 | |KEGG=C04002 | ||
}} | }} |
Revision as of 09:00, 14 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 7279-64-3 |
KEGG | C04002 |
KNApSAcK | |
CDX file | |
MOL file | BMFYB6DAk006.mol |
But-1-ene-1,2,4-tricarboxylate | |
---|---|
![]() | |
Structural Information | |
Systematic Name | cis-Homoaconitic acid |
Common Name |
|
Symbol | |
Formula | C7H8O6 |
Exact Mass | 188.032 |
Average Mass | 188.1348 |
SMILES | OC(=O)CCC(=CC(O)=O)C(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways