BMFYB4DAr001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=(2R,3S)-2,3-Dimethyl-malic acid | + | |SysName= (2R,3S) -2,3-Dimethyl-malic acid |
− | |Common Name=&&(2R,3S)-2,3-Dimethylmalate&& | + | |Common Name=&& (2R,3S) -2,3-Dimethylmalate&& |
|CAS=? | |CAS=? | ||
|KEGG=C03652 | |KEGG=C03652 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C03652 |
KNApSAcK | |
CDX file | |
MOL file | BMFYB4DAr001.mol |
(2R,3S) -2,3-Dimethylmalate | |
---|---|
Structural Information | |
Systematic Name | (2R,3S) -2,3-Dimethyl-malic acid |
Common Name |
|
Symbol | |
Formula | C6H10O5 |
Exact Mass | 162.0528 |
Average Mass | 162.1406 |
SMILES | OC(=O)[C@H](C)[C@@](C)(O)C(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways