BMCCPUAPq005
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=3-(ADP)-glyceric acid | + | |SysName=3- (ADP) -glyceric acid |
− | |Common Name=&&3-(ADP)-glycerate&& | + | |Common Name=&&3- (ADP) -glycerate&& |
|CAS=? | |CAS=? | ||
|KEGG=C02509 | |KEGG=C02509 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C02509 |
KNApSAcK | |
CDX file | |
MOL file | BMCCPUAPq005.mol |
3- (ADP) -glycerate | |
---|---|
Structural Information | |
Systematic Name | 3- (ADP) -glyceric acid |
Common Name |
|
Symbol | |
Formula | C13H19N5O13P2 |
Exact Mass | 515.0454 |
Average Mass | 515.2633 |
SMILES | OC(=O)C(O)COP(O)(=O)OP(O)(=O)OC[C@@H](O1)[C@@H](O) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |