BMCCPTPTp020
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=Xanthopterin-B2 | |SysName=Xanthopterin-B2 | ||
| − | |Common Name=&&Xanthopterin-B2&&1-(7,8-Dihydro-2,4-dihydroxypteridin-6-yl)-2-hydroxypropan-1-one&& | + | |Common Name=&&Xanthopterin-B2&&1- (7,8-Dihydro-2,4-dihydroxypteridin-6-yl) -2-hydroxypropan-1-one&& |
|CAS=14331-49-8 | |CAS=14331-49-8 | ||
|KEGG=C02333 | |KEGG=C02333 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 14331-49-8 |
| KEGG | C02333 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMCCPTPTp020.mol |
| Xanthopterin-B2 | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Xanthopterin-B2 |
| Common Name |
|
| Symbol | |
| Formula | C6H5N5O2 |
| Exact Mass | 179.0443 |
| Average Mass | 179.1364 |
| SMILES | NC(N1)=NC(N=2)=C(NC(=O)C2)C(=O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
