BMAXTP--0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(R)-S-Lactoyl-glutathione | + | |SysName= (R) -S-Lactoyl-glutathione |
|Common Name=&& | |Common Name=&& | ||
|CAS=25138-66-3 | |CAS=25138-66-3 | ||
|KEGG=C03451 | |KEGG=C03451 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 25138-66-3 |
| KEGG | C03451 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMAXTP--0001.mol |
| |
| Structural Information | |
| Systematic Name | (R) -S-Lactoyl-glutathione |
| Common Name | |
| Symbol | |
| Formula | C13H21N3O8S |
| Exact Mass | 379.1049 |
| Average Mass | 379.3872 |
| SMILES | OC(=O)CNC(=O)[C@@H](NC(=O)CC[C@H](N)C(O)=O)CSC(=O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
