BMAXDP--i001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(Ac)2-L-Lys-D-Ala | + | |SysName= (Ac) 2-L-Lys-D-Ala |
| − | |Common Name=&&(Ac)2-L-Lys-D-Ala&&(Ac)2-L-lysyl-D-alanine&& | + | |Common Name=&& (Ac) 2-L-Lys-D-Ala&& (Ac) 2-L-lysyl-D-alanine&& |
|CAS=? | |CAS=? | ||
|KEGG=C02487 | |KEGG=C02487 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | ? |
| KEGG | C02487 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMAXDP--i001.mol |
| (Ac) 2-L-Lys-D-Ala | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (Ac) 2-L-Lys-D-Ala |
| Common Name |
|
| Symbol | |
| Formula | C13H23N3O5 |
| Exact Mass | 301.1637 |
| Average Mass | 301.3389 |
| SMILES | CC(=O)NCCCC[C@H](NC(C)=O)C(=O)N[C@H](C)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
