BMAXDP--0011
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=L-Anserine | |SysName=L-Anserine | ||
| − | |Common Name=&&beta-Alanyl-N(pi)-methyl-L-histidine&&Anserine&& | + | |Common Name=&&beta-Alanyl-N (pi) -methyl-L-histidine&&Anserine&& |
|CAS=584-85-0 | |CAS=584-85-0 | ||
|KEGG=C01262 | |KEGG=C01262 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 584-85-0 |
| KEGG | C01262 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMAXDP--0011.mol |
| beta-Alanyl-N (pi) -methyl-L-histidine | |
|---|---|
| |
| Structural Information | |
| Systematic Name | L-Anserine |
| Common Name |
|
| Symbol | |
| Formula | C10H16N4O3 |
| Exact Mass | 240.1222 |
| Average Mass | 240.2592 |
| SMILES | NCCC(=O)N[C@H](C(O)=O)Cc(c1)n(C)cn1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
