BMAXB4CAr001
From Metabolomics.JP
(Difference between revisions)
Line 2: | Line 2: | ||
|SysName=L-threo-3-Methyl-aspartic acid | |SysName=L-threo-3-Methyl-aspartic acid | ||
|Common Name=&&L-threo-3-Methylaspartate&& | |Common Name=&&L-threo-3-Methylaspartate&& | ||
− | |CAS= | + | |CAS=6061-13-8 |
|KEGG=C03618 | |KEGG=C03618 | ||
}} | }} |
Revision as of 09:00, 14 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 6061-13-8 |
KEGG | C03618 |
KNApSAcK | |
CDX file | |
MOL file | BMAXB4CAr001.mol |
L-threo-3-Methylaspartate | |
---|---|
![]() | |
Structural Information | |
Systematic Name | L-threo-3-Methyl-aspartic acid |
Common Name |
|
Symbol | |
Formula | C5H9NO4 |
Exact Mass | 147.0531 |
Average Mass | 147.1293 |
SMILES | C[C@H](C(O)=O)[C@H](N)C(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways