BMACBZHOg013
From Metabolomics.JP
(Difference between revisions)
m (BMAXCCBZs013 moved to BMACBZHOg013) |
Revision as of 13:02, 8 September 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C01458 |
KNApSAcK | |
CDX file | |
MOL file | BMACBZHOg013.mol |
Tyr-OEt | |
---|---|
Structural Information | |
Systematic Name | Tyr-OEt |
Common Name |
|
Symbol | |
Formula | C11H15NO3 |
Exact Mass | 209.1051 |
Average Mass | 209.2417 |
SMILES | CCOC(=O)C(N)Cc(c1)ccc(O)c1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |