BMACBZHOg011
From Metabolomics.JP
(Difference between revisions)
m (BMAXCCBZi011 moved to BMACBZHOg011) |
Revision as of 12:18, 8 September 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 840-97-1 |
KEGG | C01657 |
KNApSAcK | |
CDX file | |
MOL file | BMACBZHOg011.mol |
Ac-Tyr-OEt | |
---|---|
![]() | |
Structural Information | |
Systematic Name | N-Acetyl-L-tyrosine ethyl ester |
Common Name |
|
Symbol | |
Formula | C13H17NO4 |
Exact Mass | 251.1157 |
Average Mass | 251.2784 |
SMILES | CCOC(=O)[C@@H](NC(C)=O)Cc(c1)ccc(O)c1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |