BMACBZHOd003
From Metabolomics.JP
(Difference between revisions)
m (BMAACCBZd003 moved to BMACBZHOd003) |
Revision as of 11:55, 8 September 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 70-78-0 |
KEGG | C02515 |
KNApSAcK | |
CDX file | |
MOL file | BMACBZHOd003.mol |
3-Iodo-L-tyrosine | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 3-Iodo-L-tyrosine |
Common Name |
|
Symbol | |
Formula | C9H10INO3 |
Exact Mass | 306.9705 |
Average Mass | 307.0854 |
SMILES | OC(=O)[C@@H](N)Cc(c1)cc(I)c(O)c1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |