BMACBZHLt001
From Metabolomics.JP
(Difference between revisions)
m (BMAXCCBZt001 moved to BMACBZHLt001) |
Revision as of 12:59, 8 September 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 6893-02-3 |
KEGG | C02465 |
KNApSAcK | |
CDX file | |
MOL file | BMACBZHLt001.mol |
Triiodothyronine | |
---|---|
Structural Information | |
Systematic Name | 3,3'5-Triiodo-L-thyronine |
Common Name |
|
Symbol | |
Formula | C15H12I3NO4 |
Exact Mass | 650.79 |
Average Mass | 650.9744 |
SMILES | OC(=O)[C@@H](N)Cc(c1)cc(I)c(Oc(c2)cc(I)c(O)c2)c(I) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways