BMAAS5ANe004
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=L-Arginine phosphate | |SysName=L-Arginine phosphate | ||
| − | |Common Name=&&L-Arginine phosphate&&N5-[Imino(phosphonoamino)methyl]L-ornithine&&omega-N-Phosphoarginine&& | + | |Common Name=&&L-Arginine phosphate&&N5- [ Imino (phosphonoamino) methyl ] L-ornithine&&omega-N-Phosphoarginine&& |
|CAS=1189-11-3 | |CAS=1189-11-3 | ||
|KEGG=C05945 | |KEGG=C05945 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 1189-11-3 |
| KEGG | C05945 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMAAS5ANe004.mol |
| L-Arginine phosphate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | L-Arginine phosphate |
| Common Name |
|
| Symbol | |
| Formula | C6H15N4O5P |
| Exact Mass | 254.078 |
| Average Mass | 254.181 |
| SMILES | N[C@@H](CCCNC(=N)NP(O)(O)=O)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
