Arbutin
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=4-hydroxypheny-.beta.-D-glucopyranoside |Common Name=&&Arbutin&&.beta.-D-p-hydroxyphenylglucopyranoside&&4-Hydroxyphenyl .beta.-D-glucopyr...) |
|||
Line 2: | Line 2: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=4-hydroxypheny- | + | |SysName=4-hydroxypheny-beta-D-glucopyranoside |
− | |Common Name=&&Arbutin&& | + | |Common Name=&&Arbutin&&beta-D-p-hydroxyphenylglucopyranoside&&4-Hydroxyphenyl beta-D-glucopyranoside&&Arbutine&&Arbutoside&&Arbutyne&&Hydroquinone glucose&&Hydroquinone beta-D-glucopyranoside&&Ursin&&Uvasol&&p-Hydroxyphenyl beta-D-glucopyranoside&&p-Hydroxyphenyl beta-D-glucoside&&beta-Arbutin&& |
|CAS=497-76-7 | |CAS=497-76-7 | ||
|KNApSAcK= | |KNApSAcK= | ||
}} | }} |
Latest revision as of 15:28, 18 December 2009
Upper classes
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 497-76-7 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | Arbutin.mol |
Arbutin | |
---|---|
Structural Information | |
Systematic Name | 4-hydroxypheny-beta-D-glucopyranoside |
Common Name |
|
Symbol | |
Formula | C12H16O7 |
Exact Mass | 272.089602866 |
Average Mass | 272.25124 |
SMILES | OCC(O1)C(O)C(O)C(O)C(Oc(c2)ccc(O)c2)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |