Phyllodulcin
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName= |Common Name=&&&& |CAS=21499-23-0 |KNApSAcK= }}) |
|||
| Line 7: | Line 7: | ||
|KNApSAcK= | |KNApSAcK= | ||
}} | }} | ||
| + | =Mass Data= | ||
Revision as of 15:17, 5 December 2009
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 21499-23-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | Phyllodulcin.mol |
| |
| Structural Information | |
| Systematic Name | |
| Common Name | |
| Symbol | |
| Formula | C16H14O5 |
| Exact Mass | 286.084123558 |
| Average Mass | 286.27936 |
| SMILES | COc(c3)c(O)cc(c3)C(O1)Cc(c2)c(c(O)cc2)C(=O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
