Magnolol
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=5,5'-Di-2-propen-1-yl-[1,1'-biphenyl]-2,2'-diol |Common Name=&&2,2'-Bichavicol&&5,5'-Diallyl-2,2'-biphenyldiol&&5,5'-di-2-Propenyl-[1,1'-b...) |
|||
Line 3: | Line 3: | ||
{{Metabolite | {{Metabolite | ||
|SysName=5,5'-Di-2-propen-1-yl-[1,1'-biphenyl]-2,2'-diol | |SysName=5,5'-Di-2-propen-1-yl-[1,1'-biphenyl]-2,2'-diol | ||
− | |Common Name=&&2,2'-Bichavicol&&5,5'-Diallyl-2,2'-biphenyldiol&&5,5'- | + | |Common Name=&&2,2'-Bichavicol&&5,5'-Diallyl-2,2'-biphenyldiol&&5,5'-Di-2-propenyl-[1,1'-biphenyl]-2,2'-diol&&5,5'-Diallyl-2,2'-biphenyldiol&&Magnolol&& |
|CAS=528-43-8 | |CAS=528-43-8 | ||
|KNApSAcK= | |KNApSAcK= | ||
}} | }} |
Revision as of 09:30, 10 December 2009
Upper classes
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 528-43-8 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | Magnolol.mol |
2,2'-Bichavicol | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 5,5'-Di-2-propen-1-yl-[1,1'-biphenyl]-2,2'-diol |
Common Name |
|
Symbol | |
Formula | C18H18O2 |
Exact Mass | 266.13067982 |
Average Mass | 266.33432 |
SMILES | C=CCc(c2)cc(c(O)c2)c(c1)c(O)ccc(CC=C)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |