LBF22403SC01
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0218 | |LipidBank=DFA0218 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA0218 |
LipidMaps | LMFA01030179 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF22403SC01.mol |
Stearidonic acid | |
---|---|
Structural Information | |
Systematic Name | 8, 12, 16, 19 (20) -Docosatetraenoic acid |
Common Name |
|
Symbol | |
Formula | C22H36O2 |
Exact Mass | 332.271530396 |
Average Mass | 332.52004000000005 |
SMILES | C(CCC(O)=O)CCCC=CCCC=CCCC=CCC=CCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | soluble in acetone, methyl alcohol and petroleum ether.<<0050>><<0051>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |