LBF20503HO09
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}}  | ||
| + | |||
{{Metabolite  | {{Metabolite  | ||
|LipidBank=DFA8118  | |LipidBank=DFA8118  | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA8118 | 
| LipidMaps | LMFA03070001 | 
| CAS | |
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20503HO09.mol | 
  
 | |
| Structural Information | |
| Systematic Name | 5S-hydroxy-6E,8Z,11Z,14Z,17Z-eicosapentaenoic acid | 
| Common Name | |
| Symbol | |
| Formula | C20H30O3 | 
| Exact Mass | 318.21949482599996 | 
| Average Mass | 318.4504 | 
| SMILES | C(CC=CCC=CCC=CC=CC(CCCC(O)=O)O)=CCC | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | lmax: 236nm e: 23,000 | 
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
